C19H27ClN4O2 — CID 120802562
1-[2-[2-(3-chlorophenyl)piperazin-1-yl]-2-oxoethyl]-3-cyclohexylurea (PubChem CID 120802562) has the molecular formula C19H27ClN4O2 and a molecular weight of 378.90 g/mol. Its IUPAC name is 1-[2-[2-(3-chlorophenyl)piperazin-1-yl]-2-oxoethyl]-3-cyclohexylurea.
| Compound Name | 1-[2-[2-(3-chlorophenyl)piperazin-1-yl]-2-oxoethyl]-3-cyclohexylurea |
|---|---|
| PubChem CID | 120802562 |
| Molecular Formula | C19H27ClN4O2 |
| Molecular Weight | 378.90 g/mol |
| Exact Mass | 378.18 |
| IUPAC Name | 1-[2-[2-(3-chlorophenyl)piperazin-1-yl]-2-oxoethyl]-3-cyclohexylurea |
| SMILES | O=C(NCC(=O)N1CCNCC1c1cccc(Cl)c1)NC1CCCCC1 |
| InChI | InChI=1S/C19H27ClN4O2/c20-15-6-4-5-14(11-15)17-12-21-9-10-24(17)18(25)13-22-19(26)23-16-7-2-1-3-8-16/h4-6,11,16-17,21H,1-3,7-10,12-13H2,(H2,22,23,26) |
| InChIKey | WAQBMKIMZAXTPV-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.90 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |