C18H19ClN2O3 — CID 120803535
1-[2-(3-chlorophenyl)piperazin-1-yl]-2-(4-hydroxyphenoxy)ethanone (PubChem CID 120803535) has the molecular formula C18H19ClN2O3 and a molecular weight of 346.81 g/mol. Its IUPAC name is 1-[2-(3-chlorophenyl)piperazin-1-yl]-2-(4-hydroxyphenoxy)ethanone.
| Compound Name | 1-[2-(3-chlorophenyl)piperazin-1-yl]-2-(4-hydroxyphenoxy)ethanone |
|---|---|
| PubChem CID | 120803535 |
| Molecular Formula | C18H19ClN2O3 |
| Molecular Weight | 346.81 g/mol |
| Exact Mass | 346.11 |
| IUPAC Name | 1-[2-(3-chlorophenyl)piperazin-1-yl]-2-(4-hydroxyphenoxy)ethanone |
| SMILES | O=C(COc1ccc(O)cc1)N1CCNCC1c1cccc(Cl)c1 |
| InChI | InChI=1S/C18H19ClN2O3/c19-14-3-1-2-13(10-14)17-11-20-8-9-21(17)18(23)12-24-16-6-4-15(22)5-7-16/h1-7,10,17,20,22H,8-9,11-12H2 |
| InChIKey | XUYNBBBLIPKZQD-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.81 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |