C18H20Cl2N2O3 — CID 120739849
1-[2-(2-chlorophenyl)piperazin-1-yl]-2-(4-hydroxyphenoxy)ethanone;hydrochloride (PubChem CID 120739849) has the molecular formula C18H20Cl2N2O3 and a molecular weight of 383.28 g/mol. Its IUPAC name is 1-[2-(2-chlorophenyl)piperazin-1-yl]-2-(4-hydroxyphenoxy)ethanone;hydrochloride.
| Compound Name | 1-[2-(2-chlorophenyl)piperazin-1-yl]-2-(4-hydroxyphenoxy)ethanone;hydrochloride |
|---|---|
| PubChem CID | 120739849 |
| Molecular Formula | C18H20Cl2N2O3 |
| Molecular Weight | 383.28 g/mol |
| Exact Mass | 382.09 |
| IUPAC Name | 1-[2-(2-chlorophenyl)piperazin-1-yl]-2-(4-hydroxyphenoxy)ethanone;hydrochloride |
| SMILES | Cl.O=C(COc1ccc(O)cc1)N1CCNCC1c1ccccc1Cl |
| InChI | InChI=1S/C18H19ClN2O3.ClH/c19-16-4-2-1-3-15(16)17-11-20-9-10-21(17)18(23)12-24-14-7-5-13(22)6-8-14;/h1-8,17,20,22H,9-12H2;1H |
| InChIKey | RLUQDKFKDBGEPB-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.28 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |