C18H19Cl2FN2O2 — CID 120739679
1-[2-(2-chlorophenyl)piperazin-1-yl]-2-(3-fluorophenoxy)ethanone;hydrochloride (PubChem CID 120739679) has the molecular formula C18H19Cl2FN2O2 and a molecular weight of 385.27 g/mol. Its IUPAC name is 1-[2-(2-chlorophenyl)piperazin-1-yl]-2-(3-fluorophenoxy)ethanone;hydrochloride.
| Compound Name | 1-[2-(2-chlorophenyl)piperazin-1-yl]-2-(3-fluorophenoxy)ethanone;hydrochloride |
|---|---|
| PubChem CID | 120739679 |
| Molecular Formula | C18H19Cl2FN2O2 |
| Molecular Weight | 385.27 g/mol |
| Exact Mass | 384.08 |
| IUPAC Name | 1-[2-(2-chlorophenyl)piperazin-1-yl]-2-(3-fluorophenoxy)ethanone;hydrochloride |
| SMILES | Cl.O=C(COc1cccc(F)c1)N1CCNCC1c1ccccc1Cl |
| InChI | InChI=1S/C18H18ClFN2O2.ClH/c19-16-7-2-1-6-15(16)17-11-21-8-9-22(17)18(23)12-24-14-5-3-4-13(20)10-14;/h1-7,10,17,21H,8-9,11-12H2;1H |
| InChIKey | BEOCTZGBRYDWBF-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.27 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |