C21H26Cl2N2O2 — CID 120739061
1-[2-(2-chlorophenyl)piperazin-1-yl]-3-(3-methoxyphenyl)butan-1-one;hydrochloride (PubChem CID 120739061) has the molecular formula C21H26Cl2N2O2 and a molecular weight of 409.36 g/mol. Its IUPAC name is 1-[2-(2-chlorophenyl)piperazin-1-yl]-3-(3-methoxyphenyl)butan-1-one;hydrochloride.
| Compound Name | 1-[2-(2-chlorophenyl)piperazin-1-yl]-3-(3-methoxyphenyl)butan-1-one;hydrochloride |
|---|---|
| PubChem CID | 120739061 |
| Molecular Formula | C21H26Cl2N2O2 |
| Molecular Weight | 409.36 g/mol |
| Exact Mass | 408.14 |
| IUPAC Name | 1-[2-(2-chlorophenyl)piperazin-1-yl]-3-(3-methoxyphenyl)butan-1-one;hydrochloride |
| SMILES | COc1cccc(C(C)CC(=O)N2CCNCC2c2ccccc2Cl)c1.Cl |
| InChI | InChI=1S/C21H25ClN2O2.ClH/c1-15(16-6-5-7-17(13-16)26-2)12-21(25)24-11-10-23-14-20(24)18-8-3-4-9-19(18)22;/h3-9,13,15,20,23H,10-12,14H2,1-2H3;1H |
| InChIKey | CLQGTXIYQKFANV-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.36 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |