C21H26Cl2N2O3 — CID 120802735
[2-(3-chlorophenyl)piperazin-1-yl]-[4-(3-methoxypropoxy)phenyl]methanone;hydrochloride (PubChem CID 120802735) has the molecular formula C21H26Cl2N2O3 and a molecular weight of 425.36 g/mol. Its IUPAC name is [2-(3-chlorophenyl)piperazin-1-yl]-[4-(3-methoxypropoxy)phenyl]methanone;hydrochloride.
| Compound Name | [2-(3-chlorophenyl)piperazin-1-yl]-[4-(3-methoxypropoxy)phenyl]methanone;hydrochloride |
|---|---|
| PubChem CID | 120802735 |
| Molecular Formula | C21H26Cl2N2O3 |
| Molecular Weight | 425.36 g/mol |
| Exact Mass | 424.13 |
| IUPAC Name | [2-(3-chlorophenyl)piperazin-1-yl]-[4-(3-methoxypropoxy)phenyl]methanone;hydrochloride |
| SMILES | COCCCOc1ccc(C(=O)N2CCNCC2c2cccc(Cl)c2)cc1.Cl |
| InChI | InChI=1S/C21H25ClN2O3.ClH/c1-26-12-3-13-27-19-8-6-16(7-9-19)21(25)24-11-10-23-15-20(24)17-4-2-5-18(22)14-17;/h2,4-9,14,20,23H,3,10-13,15H2,1H3;1H |
| InChIKey | NXQZJAGTOJJTOS-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.36 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|