C20H23ClN2O3 — CID 120801978
1-[2-(3-chlorophenyl)piperazin-1-yl]-3-(2-methoxyphenoxy)propan-1-one (PubChem CID 120801978) has the molecular formula C20H23ClN2O3 and a molecular weight of 374.87 g/mol. Its IUPAC name is 1-[2-(3-chlorophenyl)piperazin-1-yl]-3-(2-methoxyphenoxy)propan-1-one.
| Compound Name | 1-[2-(3-chlorophenyl)piperazin-1-yl]-3-(2-methoxyphenoxy)propan-1-one |
|---|---|
| PubChem CID | 120801978 |
| Molecular Formula | C20H23ClN2O3 |
| Molecular Weight | 374.87 g/mol |
| Exact Mass | 374.14 |
| IUPAC Name | 1-[2-(3-chlorophenyl)piperazin-1-yl]-3-(2-methoxyphenoxy)propan-1-one |
| SMILES | COc1ccccc1OCCC(=O)N1CCNCC1c1cccc(Cl)c1 |
| InChI | InChI=1S/C20H23ClN2O3/c1-25-18-7-2-3-8-19(18)26-12-9-20(24)23-11-10-22-14-17(23)15-5-4-6-16(21)13-15/h2-8,13,17,22H,9-12,14H2,1H3 |
| InChIKey | LTSSLDNNTWROIV-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.87 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |