C16H24Cl2N4O2 — CID 120803550
[5-[2-(3-chlorophenyl)piperazin-1-yl]-5-oxopentyl]urea;hydrochloride (PubChem CID 120803550) has the molecular formula C16H24Cl2N4O2 and a molecular weight of 375.30 g/mol. Its IUPAC name is [5-[2-(3-chlorophenyl)piperazin-1-yl]-5-oxopentyl]urea;hydrochloride.
| Compound Name | [5-[2-(3-chlorophenyl)piperazin-1-yl]-5-oxopentyl]urea;hydrochloride |
|---|---|
| PubChem CID | 120803550 |
| Molecular Formula | C16H24Cl2N4O2 |
| Molecular Weight | 375.30 g/mol |
| Exact Mass | 374.13 |
| IUPAC Name | [5-[2-(3-chlorophenyl)piperazin-1-yl]-5-oxopentyl]urea;hydrochloride |
| SMILES | Cl.NC(=O)NCCCCC(=O)N1CCNCC1c1cccc(Cl)c1 |
| InChI | InChI=1S/C16H23ClN4O2.ClH/c17-13-5-3-4-12(10-13)14-11-19-8-9-21(14)15(22)6-1-2-7-20-16(18)23;/h3-5,10,14,19H,1-2,6-9,11H2,(H3,18,20,23);1H |
| InChIKey | JNSBONXUZSBVHB-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.30 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|