C19H25ClN4O3 — CID 120801960
3-[4-[2-(3-chlorophenyl)piperazin-1-yl]-4-oxobutyl]-5,5-dimethylimidazolidine-2,4-dione (PubChem CID 120801960) has the molecular formula C19H25ClN4O3 and a molecular weight of 392.89 g/mol. Its IUPAC name is 3-[4-[2-(3-chlorophenyl)piperazin-1-yl]-4-oxobutyl]-5,5-dimethylimidazolidine-2,4-dione.
| Compound Name | 3-[4-[2-(3-chlorophenyl)piperazin-1-yl]-4-oxobutyl]-5,5-dimethylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 120801960 |
| Molecular Formula | C19H25ClN4O3 |
| Molecular Weight | 392.89 g/mol |
| Exact Mass | 392.16 |
| IUPAC Name | 3-[4-[2-(3-chlorophenyl)piperazin-1-yl]-4-oxobutyl]-5,5-dimethylimidazolidine-2,4-dione |
| SMILES | CC1(C)NC(=O)N(CCCC(=O)N2CCNCC2c2cccc(Cl)c2)C1=O |
| InChI | InChI=1S/C19H25ClN4O3/c1-19(2)17(26)24(18(27)22-19)9-4-7-16(25)23-10-8-21-12-15(23)13-5-3-6-14(20)11-13/h3,5-6,11,15,21H,4,7-10,12H2,1-2H3,(H,22,27) |
| InChIKey | FJCDUXDWWWOSIF-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.89 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|