C21H33ClN4O2 — CID 120740666
1-cyclohexyl-3-[2-[2-(4-ethylphenyl)piperazin-1-yl]-2-oxoethyl]urea;hydrochloride (PubChem CID 120740666) has the molecular formula C21H33ClN4O2 and a molecular weight of 408.97 g/mol. Its IUPAC name is 1-cyclohexyl-3-[2-[2-(4-ethylphenyl)piperazin-1-yl]-2-oxoethyl]urea;hydrochloride.
| Compound Name | 1-cyclohexyl-3-[2-[2-(4-ethylphenyl)piperazin-1-yl]-2-oxoethyl]urea;hydrochloride |
|---|---|
| PubChem CID | 120740666 |
| Molecular Formula | C21H33ClN4O2 |
| Molecular Weight | 408.97 g/mol |
| Exact Mass | 408.23 |
| IUPAC Name | 1-cyclohexyl-3-[2-[2-(4-ethylphenyl)piperazin-1-yl]-2-oxoethyl]urea;hydrochloride |
| SMILES | CCc1ccc(C2CNCCN2C(=O)CNC(=O)NC2CCCCC2)cc1.Cl |
| InChI | InChI=1S/C21H32N4O2.ClH/c1-2-16-8-10-17(11-9-16)19-14-22-12-13-25(19)20(26)15-23-21(27)24-18-6-4-3-5-7-18;/h8-11,18-19,22H,2-7,12-15H2,1H3,(H2,23,24,27);1H |
| InChIKey | SGXAPZUDXNUGKH-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.97 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |