C20H34Cl2N4O — CID 120740374
1-[2-(4-ethylphenyl)piperazin-1-yl]-2-(4-ethylpiperazin-1-yl)ethanone;dihydrochloride (PubChem CID 120740374) has the molecular formula C20H34Cl2N4O and a molecular weight of 417.43 g/mol. Its IUPAC name is 1-[2-(4-ethylphenyl)piperazin-1-yl]-2-(4-ethylpiperazin-1-yl)ethanone;dihydrochloride.
| Compound Name | 1-[2-(4-ethylphenyl)piperazin-1-yl]-2-(4-ethylpiperazin-1-yl)ethanone;dihydrochloride |
|---|---|
| PubChem CID | 120740374 |
| Molecular Formula | C20H34Cl2N4O |
| Molecular Weight | 417.43 g/mol |
| Exact Mass | 416.21 |
| IUPAC Name | 1-[2-(4-ethylphenyl)piperazin-1-yl]-2-(4-ethylpiperazin-1-yl)ethanone;dihydrochloride |
| SMILES | CCc1ccc(C2CNCCN2C(=O)CN2CCN(CC)CC2)cc1.Cl.Cl |
| InChI | InChI=1S/C20H32N4O.2ClH/c1-3-17-5-7-18(8-6-17)19-15-21-9-10-24(19)20(25)16-23-13-11-22(4-2)12-14-23;;/h5-8,19,21H,3-4,9-16H2,1-2H3;2*1H |
| InChIKey | GTGQDHLCDPZZLA-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 38.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.43 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |