C18H25ClN4O — CID 120740892
1-[2-(4-ethylphenyl)piperazin-1-yl]-2-(5-methyl-1H-pyrazol-3-yl)ethanone;hydrochloride (PubChem CID 120740892) has the molecular formula C18H25ClN4O and a molecular weight of 348.88 g/mol. Its IUPAC name is 1-[2-(4-ethylphenyl)piperazin-1-yl]-2-(5-methyl-1H-pyrazol-3-yl)ethanone;hydrochloride.
| Compound Name | 1-[2-(4-ethylphenyl)piperazin-1-yl]-2-(5-methyl-1H-pyrazol-3-yl)ethanone;hydrochloride |
|---|---|
| PubChem CID | 120740892 |
| Molecular Formula | C18H25ClN4O |
| Molecular Weight | 348.88 g/mol |
| Exact Mass | 348.17 |
| IUPAC Name | 1-[2-(4-ethylphenyl)piperazin-1-yl]-2-(5-methyl-1H-pyrazol-3-yl)ethanone;hydrochloride |
| SMILES | CCc1ccc(C2CNCCN2C(=O)Cc2cc(C)[nH]n2)cc1.Cl |
| InChI | InChI=1S/C18H24N4O.ClH/c1-3-14-4-6-15(7-5-14)17-12-19-8-9-22(17)18(23)11-16-10-13(2)20-21-16;/h4-7,10,17,19H,3,8-9,11-12H2,1-2H3,(H,20,21);1H |
| InChIKey | CFUQMTYCMBBERI-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.88 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |