C18H23ClN2OS — CID 120741698
1-[2-(4-ethylphenyl)piperazin-1-yl]-2-thiophen-2-ylethanone;hydrochloride (PubChem CID 120741698) has the molecular formula C18H23ClN2OS and a molecular weight of 350.92 g/mol. Its IUPAC name is 1-[2-(4-ethylphenyl)piperazin-1-yl]-2-thiophen-2-ylethanone;hydrochloride.
| Compound Name | 1-[2-(4-ethylphenyl)piperazin-1-yl]-2-thiophen-2-ylethanone;hydrochloride |
|---|---|
| PubChem CID | 120741698 |
| Molecular Formula | C18H23ClN2OS |
| Molecular Weight | 350.92 g/mol |
| Exact Mass | 350.12 |
| IUPAC Name | 1-[2-(4-ethylphenyl)piperazin-1-yl]-2-thiophen-2-ylethanone;hydrochloride |
| SMILES | CCc1ccc(C2CNCCN2C(=O)Cc2cccs2)cc1.Cl |
| InChI | InChI=1S/C18H22N2OS.ClH/c1-2-14-5-7-15(8-6-14)17-13-19-9-10-20(17)18(21)12-16-4-3-11-22-16;/h3-8,11,17,19H,2,9-10,12-13H2,1H3;1H |
| InChIKey | IIXFNCRTSVUHFW-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.92 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |