C14H16ClN3O2S — CID 120803117
(4R)-4-[2-(3-chlorophenyl)piperazine-1-carbonyl]-1,3-thiazolidin-2-one (PubChem CID 120803117) has the molecular formula C14H16ClN3O2S and a molecular weight of 325.82 g/mol. Its IUPAC name is (4R)-4-[2-(3-chlorophenyl)piperazine-1-carbonyl]-1,3-thiazolidin-2-one.
| Compound Name | (4R)-4-[2-(3-chlorophenyl)piperazine-1-carbonyl]-1,3-thiazolidin-2-one |
|---|---|
| PubChem CID | 120803117 |
| Molecular Formula | C14H16ClN3O2S |
| Molecular Weight | 325.82 g/mol |
| Exact Mass | 325.07 |
| IUPAC Name | (4R)-4-[2-(3-chlorophenyl)piperazine-1-carbonyl]-1,3-thiazolidin-2-one |
| SMILES | O=C1N[C@H](C(=O)N2CCNCC2c2cccc(Cl)c2)CS1 |
| InChI | InChI=1S/C14H16ClN3O2S/c15-10-3-1-2-9(6-10)12-7-16-4-5-18(12)13(19)11-8-21-14(20)17-11/h1-3,6,11-12,16H,4-5,7-8H2,(H,17,20)/t11-,12?/m0/s1 |
| InChIKey | VLWAVJXYFIGMEW-PXYINDEMSA-N |
| XLogP | 1.64 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.82 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|