C13H16N4O2S — CID 120732061
(4R)-4-(2-pyridin-3-ylpiperazine-1-carbonyl)-1,3-thiazolidin-2-one (PubChem CID 120732061) has the molecular formula C13H16N4O2S and a molecular weight of 292.36 g/mol. Its IUPAC name is (4R)-4-(2-pyridin-3-ylpiperazine-1-carbonyl)-1,3-thiazolidin-2-one.
| Compound Name | (4R)-4-(2-pyridin-3-ylpiperazine-1-carbonyl)-1,3-thiazolidin-2-one |
|---|---|
| PubChem CID | 120732061 |
| Molecular Formula | C13H16N4O2S |
| Molecular Weight | 292.36 g/mol |
| Exact Mass | 292.10 |
| IUPAC Name | (4R)-4-(2-pyridin-3-ylpiperazine-1-carbonyl)-1,3-thiazolidin-2-one |
| SMILES | O=C1N[C@H](C(=O)N2CCNCC2c2cccnc2)CS1 |
| InChI | InChI=1S/C13H16N4O2S/c18-12(10-8-20-13(19)16-10)17-5-4-15-7-11(17)9-2-1-3-14-6-9/h1-3,6,10-11,15H,4-5,7-8H2,(H,16,19)/t10-,11?/m0/s1 |
| InChIKey | XEMKQPPGQLXTMK-VUWPPUDQSA-N |
| XLogP | 0.38 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.36 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|