C15H20ClN3O3S — CID 120735018
(4R)-4-[2-(2-methoxyphenyl)piperazine-1-carbonyl]-1,3-thiazolidin-2-one;hydrochloride (PubChem CID 120735018) has the molecular formula C15H20ClN3O3S and a molecular weight of 357.86 g/mol. Its IUPAC name is (4R)-4-[2-(2-methoxyphenyl)piperazine-1-carbonyl]-1,3-thiazolidin-2-one;hydrochloride.
| Compound Name | (4R)-4-[2-(2-methoxyphenyl)piperazine-1-carbonyl]-1,3-thiazolidin-2-one;hydrochloride |
|---|---|
| PubChem CID | 120735018 |
| Molecular Formula | C15H20ClN3O3S |
| Molecular Weight | 357.86 g/mol |
| Exact Mass | 357.09 |
| IUPAC Name | (4R)-4-[2-(2-methoxyphenyl)piperazine-1-carbonyl]-1,3-thiazolidin-2-one;hydrochloride |
| SMILES | COc1ccccc1C1CNCCN1C(=O)[C@@H]1CSC(=O)N1.Cl |
| InChI | InChI=1S/C15H19N3O3S.ClH/c1-21-13-5-3-2-4-10(13)12-8-16-6-7-18(12)14(19)11-9-22-15(20)17-11;/h2-5,11-12,16H,6-9H2,1H3,(H,17,20);1H/t11-,12?;/m0./s1 |
| InChIKey | FZNFPIPSVMDUHI-YLIVSKOQSA-N |
| XLogP | 1.41 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.86 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|