C16H22ClN3O3S — CID 120734352
3-[2-[2-(2-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]-1,3-thiazolidin-2-one;hydrochloride (PubChem CID 120734352) has the molecular formula C16H22ClN3O3S and a molecular weight of 371.89 g/mol. Its IUPAC name is 3-[2-[2-(2-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]-1,3-thiazolidin-2-one;hydrochloride.
| Compound Name | 3-[2-[2-(2-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]-1,3-thiazolidin-2-one;hydrochloride |
|---|---|
| PubChem CID | 120734352 |
| Molecular Formula | C16H22ClN3O3S |
| Molecular Weight | 371.89 g/mol |
| Exact Mass | 371.11 |
| IUPAC Name | 3-[2-[2-(2-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]-1,3-thiazolidin-2-one;hydrochloride |
| SMILES | COc1ccccc1C1CNCCN1C(=O)CN1CCSC1=O.Cl |
| InChI | InChI=1S/C16H21N3O3S.ClH/c1-22-14-5-3-2-4-12(14)13-10-17-6-7-19(13)15(20)11-18-8-9-23-16(18)21;/h2-5,13,17H,6-11H2,1H3;1H |
| InChIKey | OZYXVALGQJYFRN-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.89 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|