C17H21ClN4O5 — CID 120733120
1-[2-[2-(2-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]-3-methylimidazolidine-2,4,5-trione;hydrochloride (PubChem CID 120733120) has the molecular formula C17H21ClN4O5 and a molecular weight of 396.83 g/mol. Its IUPAC name is 1-[2-[2-(2-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]-3-methylimidazolidine-2,4,5-trione;hydrochloride.
| Compound Name | 1-[2-[2-(2-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]-3-methylimidazolidine-2,4,5-trione;hydrochloride |
|---|---|
| PubChem CID | 120733120 |
| Molecular Formula | C17H21ClN4O5 |
| Molecular Weight | 396.83 g/mol |
| Exact Mass | 396.12 |
| IUPAC Name | 1-[2-[2-(2-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]-3-methylimidazolidine-2,4,5-trione;hydrochloride |
| SMILES | COc1ccccc1C1CNCCN1C(=O)CN1C(=O)C(=O)N(C)C1=O.Cl |
| InChI | InChI=1S/C17H20N4O5.ClH/c1-19-15(23)16(24)21(17(19)25)10-14(22)20-8-7-18-9-12(20)11-5-3-4-6-13(11)26-2;/h3-6,12,18H,7-10H2,1-2H3;1H |
| InChIKey | YXZUPFYJHHCJNL-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 99.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.83 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|