C21H24ClN3O3 — CID 120735296
2-[2-[2-(2-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]-3H-isoindol-1-one;hydrochloride (PubChem CID 120735296) has the molecular formula C21H24ClN3O3 and a molecular weight of 401.89 g/mol. Its IUPAC name is 2-[2-[2-(2-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]-3H-isoindol-1-one;hydrochloride.
| Compound Name | 2-[2-[2-(2-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]-3H-isoindol-1-one;hydrochloride |
|---|---|
| PubChem CID | 120735296 |
| Molecular Formula | C21H24ClN3O3 |
| Molecular Weight | 401.89 g/mol |
| Exact Mass | 401.15 |
| IUPAC Name | 2-[2-[2-(2-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]-3H-isoindol-1-one;hydrochloride |
| SMILES | COc1ccccc1C1CNCCN1C(=O)CN1Cc2ccccc2C1=O.Cl |
| InChI | InChI=1S/C21H23N3O3.ClH/c1-27-19-9-5-4-8-17(19)18-12-22-10-11-24(18)20(25)14-23-13-15-6-2-3-7-16(15)21(23)26;/h2-9,18,22H,10-14H2,1H3;1H |
| InChIKey | OMXFDXCWNVSXKY-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.89 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |