C16H25ClN2O4S — CID 120734946
1-[2-(2-methoxyphenyl)piperazin-1-yl]-4-methylsulfonylbutan-1-one;hydrochloride (PubChem CID 120734946) has the molecular formula C16H25ClN2O4S and a molecular weight of 376.91 g/mol. Its IUPAC name is 1-[2-(2-methoxyphenyl)piperazin-1-yl]-4-methylsulfonylbutan-1-one;hydrochloride.
| Compound Name | 1-[2-(2-methoxyphenyl)piperazin-1-yl]-4-methylsulfonylbutan-1-one;hydrochloride |
|---|---|
| PubChem CID | 120734946 |
| Molecular Formula | C16H25ClN2O4S |
| Molecular Weight | 376.91 g/mol |
| Exact Mass | 376.12 |
| IUPAC Name | 1-[2-(2-methoxyphenyl)piperazin-1-yl]-4-methylsulfonylbutan-1-one;hydrochloride |
| SMILES | COc1ccccc1C1CNCCN1C(=O)CCCS(C)(=O)=O.Cl |
| InChI | InChI=1S/C16H24N2O4S.ClH/c1-22-15-7-4-3-6-13(15)14-12-17-9-10-18(14)16(19)8-5-11-23(2,20)21;/h3-4,6-7,14,17H,5,8-12H2,1-2H3;1H |
| InChIKey | MELAUTFZTUYKLM-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.91 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |