C15H22Cl2N2O3S — CID 120739571
1-[2-(2-chlorophenyl)piperazin-1-yl]-4-methylsulfonylbutan-1-one;hydrochloride (PubChem CID 120739571) has the molecular formula C15H22Cl2N2O3S and a molecular weight of 381.33 g/mol. Its IUPAC name is 1-[2-(2-chlorophenyl)piperazin-1-yl]-4-methylsulfonylbutan-1-one;hydrochloride.
| Compound Name | 1-[2-(2-chlorophenyl)piperazin-1-yl]-4-methylsulfonylbutan-1-one;hydrochloride |
|---|---|
| PubChem CID | 120739571 |
| Molecular Formula | C15H22Cl2N2O3S |
| Molecular Weight | 381.33 g/mol |
| Exact Mass | 380.07 |
| IUPAC Name | 1-[2-(2-chlorophenyl)piperazin-1-yl]-4-methylsulfonylbutan-1-one;hydrochloride |
| SMILES | CS(=O)(=O)CCCC(=O)N1CCNCC1c1ccccc1Cl.Cl |
| InChI | InChI=1S/C15H21ClN2O3S.ClH/c1-22(20,21)10-4-7-15(19)18-9-8-17-11-14(18)12-5-2-3-6-13(12)16;/h2-3,5-6,14,17H,4,7-11H2,1H3;1H |
| InChIKey | RDTVYRHBHKIBQG-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.33 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |