C19H26N4O4 — CID 120735391
3-[4-[2-(2-methoxyphenyl)piperazin-1-yl]-4-oxobutyl]-1-methylimidazolidine-2,4-dione (PubChem CID 120735391) has the molecular formula C19H26N4O4 and a molecular weight of 374.44 g/mol. Its IUPAC name is 3-[4-[2-(2-methoxyphenyl)piperazin-1-yl]-4-oxobutyl]-1-methylimidazolidine-2,4-dione.
| Compound Name | 3-[4-[2-(2-methoxyphenyl)piperazin-1-yl]-4-oxobutyl]-1-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 120735391 |
| Molecular Formula | C19H26N4O4 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.20 |
| IUPAC Name | 3-[4-[2-(2-methoxyphenyl)piperazin-1-yl]-4-oxobutyl]-1-methylimidazolidine-2,4-dione |
| SMILES | COc1ccccc1C1CNCCN1C(=O)CCCN1C(=O)CN(C)C1=O |
| InChI | InChI=1S/C19H26N4O4/c1-21-13-18(25)23(19(21)26)10-5-8-17(24)22-11-9-20-12-15(22)14-6-3-4-7-16(14)27-2/h3-4,6-7,15,20H,5,8-13H2,1-2H3 |
| InChIKey | RBCXYCZBZRUOMQ-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|