C15H22ClN3O2 — CID 120729798
oxan-2-yl-(2-pyridin-3-ylpiperazin-1-yl)methanone;hydrochloride (PubChem CID 120729798) has the molecular formula C15H22ClN3O2 and a molecular weight of 311.81 g/mol. Its IUPAC name is oxan-2-yl-(2-pyridin-3-ylpiperazin-1-yl)methanone;hydrochloride.
| Compound Name | oxan-2-yl-(2-pyridin-3-ylpiperazin-1-yl)methanone;hydrochloride |
|---|---|
| PubChem CID | 120729798 |
| Molecular Formula | C15H22ClN3O2 |
| Molecular Weight | 311.81 g/mol |
| Exact Mass | 311.14 |
| IUPAC Name | oxan-2-yl-(2-pyridin-3-ylpiperazin-1-yl)methanone;hydrochloride |
| SMILES | Cl.O=C(C1CCCCO1)N1CCNCC1c1cccnc1 |
| InChI | InChI=1S/C15H21N3O2.ClH/c19-15(14-5-1-2-9-20-14)18-8-7-17-11-13(18)12-4-3-6-16-10-12;/h3-4,6,10,13-14,17H,1-2,5,7-9,11H2;1H |
| InChIKey | WWRSQSQCCIMTJV-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.81 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |