C15H19ClN2O3S — CID 120802900
[2-(3-chlorophenyl)piperazin-1-yl]-(1,1-dioxothiolan-3-yl)methanone (PubChem CID 120802900) has the molecular formula C15H19ClN2O3S and a molecular weight of 342.85 g/mol. Its IUPAC name is [2-(3-chlorophenyl)piperazin-1-yl]-(1,1-dioxothiolan-3-yl)methanone.
| Compound Name | [2-(3-chlorophenyl)piperazin-1-yl]-(1,1-dioxothiolan-3-yl)methanone |
|---|---|
| PubChem CID | 120802900 |
| Molecular Formula | C15H19ClN2O3S |
| Molecular Weight | 342.85 g/mol |
| Exact Mass | 342.08 |
| IUPAC Name | [2-(3-chlorophenyl)piperazin-1-yl]-(1,1-dioxothiolan-3-yl)methanone |
| SMILES | O=C(C1CCS(=O)(=O)C1)N1CCNCC1c1cccc(Cl)c1 |
| InChI | InChI=1S/C15H19ClN2O3S/c16-13-3-1-2-11(8-13)14-9-17-5-6-18(14)15(19)12-4-7-22(20,21)10-12/h1-3,8,12,14,17H,4-7,9-10H2 |
| InChIKey | ZSGKAZUSALTAQA-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.85 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |