C16H13ClINOS — CID 122331337
[2-(3-chlorophenyl)-1,3-thiazolidin-3-yl]-(4-iodophenyl)methanone (PubChem CID 122331337) has the molecular formula C16H13ClINOS and a molecular weight of 429.71 g/mol. Its IUPAC name is [2-(3-chlorophenyl)-1,3-thiazolidin-3-yl]-(4-iodophenyl)methanone.
| Compound Name | [2-(3-chlorophenyl)-1,3-thiazolidin-3-yl]-(4-iodophenyl)methanone |
|---|---|
| PubChem CID | 122331337 |
| Molecular Formula | C16H13ClINOS |
| Molecular Weight | 429.71 g/mol |
| Exact Mass | 428.95 |
| IUPAC Name | [2-(3-chlorophenyl)-1,3-thiazolidin-3-yl]-(4-iodophenyl)methanone |
| SMILES | O=C(c1ccc(I)cc1)N1CCSC1c1cccc(Cl)c1 |
| InChI | InChI=1S/C16H13ClINOS/c17-13-3-1-2-12(10-13)16-19(8-9-21-16)15(20)11-4-6-14(18)7-5-11/h1-7,10,16H,8-9H2 |
| InChIKey | CTFANHPEWLQZFD-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.71 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|