C17H16ClNOS — CID 42781088
1-[2-(3-chlorophenyl)-1,3-thiazolidin-3-yl]-2-phenylethanone (PubChem CID 42781088) has the molecular formula C17H16ClNOS and a molecular weight of 317.84 g/mol. Its IUPAC name is 1-[2-(3-chlorophenyl)-1,3-thiazolidin-3-yl]-2-phenylethanone.
| Compound Name | 1-[2-(3-chlorophenyl)-1,3-thiazolidin-3-yl]-2-phenylethanone |
|---|---|
| PubChem CID | 42781088 |
| Molecular Formula | C17H16ClNOS |
| Molecular Weight | 317.84 g/mol |
| Exact Mass | 317.06 |
| IUPAC Name | 1-[2-(3-chlorophenyl)-1,3-thiazolidin-3-yl]-2-phenylethanone |
| SMILES | O=C(Cc1ccccc1)N1CCSC1c1cccc(Cl)c1 |
| InChI | InChI=1S/C17H16ClNOS/c18-15-8-4-7-14(12-15)17-19(9-10-21-17)16(20)11-13-5-2-1-3-6-13/h1-8,12,17H,9-11H2 |
| InChIKey | KPOKXLCRLHJKOY-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.84 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |