C15H17Cl2NOS — CID 5011007
3-cyclohexyl-2-(2,3-dichlorophenyl)-1,3-thiazolidin-4-one (PubChem CID 5011007) has the molecular formula C15H17Cl2NOS and a molecular weight of 330.28 g/mol. Its IUPAC name is 3-cyclohexyl-2-(2,3-dichlorophenyl)-1,3-thiazolidin-4-one.
| Compound Name | 3-cyclohexyl-2-(2,3-dichlorophenyl)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 5011007 |
| Molecular Formula | C15H17Cl2NOS |
| Molecular Weight | 330.28 g/mol |
| Exact Mass | 329.04 |
| IUPAC Name | 3-cyclohexyl-2-(2,3-dichlorophenyl)-1,3-thiazolidin-4-one |
| SMILES | O=C1CSC(c2cccc(Cl)c2Cl)N1C1CCCCC1 |
| InChI | InChI=1S/C15H17Cl2NOS/c16-12-8-4-7-11(14(12)17)15-18(13(19)9-20-15)10-5-2-1-3-6-10/h4,7-8,10,15H,1-3,5-6,9H2 |
| InChIKey | LWHCGMNAHOBEJN-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.28 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |