C11H12ClNOS — CID 7289124
1-[(2R)-2-(3-chlorophenyl)-1,3-thiazolidin-3-yl]ethanone (PubChem CID 7289124) has the molecular formula C11H12ClNOS and a molecular weight of 241.74 g/mol. Its IUPAC name is 1-[(2R)-2-(3-chlorophenyl)-1,3-thiazolidin-3-yl]ethanone.
| Compound Name | 1-[(2R)-2-(3-chlorophenyl)-1,3-thiazolidin-3-yl]ethanone |
|---|---|
| PubChem CID | 7289124 |
| Molecular Formula | C11H12ClNOS |
| Molecular Weight | 241.74 g/mol |
| Exact Mass | 241.03 |
| IUPAC Name | 1-[(2R)-2-(3-chlorophenyl)-1,3-thiazolidin-3-yl]ethanone |
| SMILES | CC(=O)N1CCS[C@@H]1c1cccc(Cl)c1 |
| InChI | InChI=1S/C11H12ClNOS/c1-8(14)13-5-6-15-11(13)9-3-2-4-10(12)7-9/h2-4,7,11H,5-6H2,1H3/t11-/m1/s1 |
| InChIKey | MWKJONOSLFXIDV-LLVKDONJSA-N |
| XLogP | 2.93 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.74 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |