C22H26N2O2S — CID 1025273
(2S)-N-cyclohexyl-2-(3-phenoxyphenyl)-1,3-thiazolidine-3-carboxamide (PubChem CID 1025273) has the molecular formula C22H26N2O2S and a molecular weight of 382.53 g/mol. Its IUPAC name is (2S)-N-cyclohexyl-2-(3-phenoxyphenyl)-1,3-thiazolidine-3-carboxamide.
| Compound Name | (2S)-N-cyclohexyl-2-(3-phenoxyphenyl)-1,3-thiazolidine-3-carboxamide |
|---|---|
| PubChem CID | 1025273 |
| Molecular Formula | C22H26N2O2S |
| Molecular Weight | 382.53 g/mol |
| Exact Mass | 382.17 |
| IUPAC Name | (2S)-N-cyclohexyl-2-(3-phenoxyphenyl)-1,3-thiazolidine-3-carboxamide |
| SMILES | O=C(NC1CCCCC1)N1CCS[C@H]1c1cccc(Oc2ccccc2)c1 |
| InChI | InChI=1S/C22H26N2O2S/c25-22(23-18-9-3-1-4-10-18)24-14-15-27-21(24)17-8-7-13-20(16-17)26-19-11-5-2-6-12-19/h2,5-8,11-13,16,18,21H,1,3-4,9-10,14-15H2,(H,23,25)/t21-/m0/s1 |
| InChIKey | UXDBDGJNSYTBNN-NRFANRHFSA-N |
| XLogP | 5.57 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.53 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |