C24H24N2O3S — CID 1025381
(2R)-N-(2-ethoxyphenyl)-2-(3-phenoxyphenyl)-1,3-thiazolidine-3-carboxamide (PubChem CID 1025381) has the molecular formula C24H24N2O3S and a molecular weight of 420.53 g/mol. Its IUPAC name is (2R)-N-(2-ethoxyphenyl)-2-(3-phenoxyphenyl)-1,3-thiazolidine-3-carboxamide.
| Compound Name | (2R)-N-(2-ethoxyphenyl)-2-(3-phenoxyphenyl)-1,3-thiazolidine-3-carboxamide |
|---|---|
| PubChem CID | 1025381 |
| Molecular Formula | C24H24N2O3S |
| Molecular Weight | 420.53 g/mol |
| Exact Mass | 420.15 |
| IUPAC Name | (2R)-N-(2-ethoxyphenyl)-2-(3-phenoxyphenyl)-1,3-thiazolidine-3-carboxamide |
| SMILES | CCOc1ccccc1NC(=O)N1CCS[C@@H]1c1cccc(Oc2ccccc2)c1 |
| InChI | InChI=1S/C24H24N2O3S/c1-2-28-22-14-7-6-13-21(22)25-24(27)26-15-16-30-23(26)18-9-8-12-20(17-18)29-19-10-4-3-5-11-19/h3-14,17,23H,2,15-16H2,1H3,(H,25,27)/t23-/m1/s1 |
| InChIKey | RYDUMICKWIPBQG-HSZRJFAPSA-N |
| XLogP | 6.16 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.53 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |