C18H26N2O3S — CID 5082460
N-cyclohexyl-2-(2,4-dimethoxyphenyl)-1,3-thiazolidine-3-carboxamide (PubChem CID 5082460) has the molecular formula C18H26N2O3S and a molecular weight of 350.48 g/mol. Its IUPAC name is N-cyclohexyl-2-(2,4-dimethoxyphenyl)-1,3-thiazolidine-3-carboxamide.
| Compound Name | N-cyclohexyl-2-(2,4-dimethoxyphenyl)-1,3-thiazolidine-3-carboxamide |
|---|---|
| PubChem CID | 5082460 |
| Molecular Formula | C18H26N2O3S |
| Molecular Weight | 350.48 g/mol |
| Exact Mass | 350.17 |
| IUPAC Name | N-cyclohexyl-2-(2,4-dimethoxyphenyl)-1,3-thiazolidine-3-carboxamide |
| SMILES | COc1ccc(C2SCCN2C(=O)NC2CCCCC2)c(OC)c1 |
| InChI | InChI=1S/C18H26N2O3S/c1-22-14-8-9-15(16(12-14)23-2)17-20(10-11-24-17)18(21)19-13-6-4-3-5-7-13/h8-9,12-13,17H,3-7,10-11H2,1-2H3,(H,19,21) |
| InChIKey | DUFWRZOSPGZXLQ-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.48 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |