C18H20N2O3S — CID 3309757
2-(2,5-dimethoxyphenyl)-N-phenyl-1,3-thiazolidine-3-carboxamide (PubChem CID 3309757) has the molecular formula C18H20N2O3S and a molecular weight of 344.44 g/mol. Its IUPAC name is 2-(2,5-dimethoxyphenyl)-N-phenyl-1,3-thiazolidine-3-carboxamide.
| Compound Name | 2-(2,5-dimethoxyphenyl)-N-phenyl-1,3-thiazolidine-3-carboxamide |
|---|---|
| PubChem CID | 3309757 |
| Molecular Formula | C18H20N2O3S |
| Molecular Weight | 344.44 g/mol |
| Exact Mass | 344.12 |
| IUPAC Name | 2-(2,5-dimethoxyphenyl)-N-phenyl-1,3-thiazolidine-3-carboxamide |
| SMILES | COc1ccc(OC)c(C2SCCN2C(=O)Nc2ccccc2)c1 |
| InChI | InChI=1S/C18H20N2O3S/c1-22-14-8-9-16(23-2)15(12-14)17-20(10-11-24-17)18(21)19-13-6-4-3-5-7-13/h3-9,12,17H,10-11H2,1-2H3,(H,19,21) |
| InChIKey | BONKHZHHADYMTM-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.44 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |