C18H20N2O3S — CID 816356
(2R)-2-(3,5-dimethoxyphenyl)-N-phenyl-1,3-thiazolidine-3-carboxamide (PubChem CID 816356) has the molecular formula C18H20N2O3S and a molecular weight of 344.44 g/mol. Its IUPAC name is (2R)-2-(3,5-dimethoxyphenyl)-N-phenyl-1,3-thiazolidine-3-carboxamide.
| Compound Name | (2R)-2-(3,5-dimethoxyphenyl)-N-phenyl-1,3-thiazolidine-3-carboxamide |
|---|---|
| PubChem CID | 816356 |
| Molecular Formula | C18H20N2O3S |
| Molecular Weight | 344.44 g/mol |
| Exact Mass | 344.12 |
| IUPAC Name | (2R)-2-(3,5-dimethoxyphenyl)-N-phenyl-1,3-thiazolidine-3-carboxamide |
| SMILES | COc1cc(OC)cc([C@H]2SCCN2C(=O)Nc2ccccc2)c1 |
| InChI | InChI=1S/C18H20N2O3S/c1-22-15-10-13(11-16(12-15)23-2)17-20(8-9-24-17)18(21)19-14-6-4-3-5-7-14/h3-7,10-12,17H,8-9H2,1-2H3,(H,19,21)/t17-/m1/s1 |
| InChIKey | PVXYFRRYSPHUSE-QGZVFWFLSA-N |
| XLogP | 3.98 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.44 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |