C20H25N3O2S — CID 7237051
(E)-N-[(2R)-butan-2-yl]-N-[2-[(4,5-dimethyl-1,3-thiazol-2-yl)amino]-2-oxoethyl]-3-phenylprop-2-enamide (PubChem CID 7237051) has the molecular formula C20H25N3O2S and a molecular weight of 371.51 g/mol. Its IUPAC name is (E)-N-[(2R)-butan-2-yl]-N-[2-[(4,5-dimethyl-1,3-thiazol-2-yl)amino]-2-oxoethyl]-3-phenylprop-2-enamide.
| Compound Name | (E)-N-[(2R)-butan-2-yl]-N-[2-[(4,5-dimethyl-1,3-thiazol-2-yl)amino]-2-oxoethyl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 7237051 |
| Molecular Formula | C20H25N3O2S |
| Molecular Weight | 371.51 g/mol |
| Exact Mass | 371.17 |
| IUPAC Name | (E)-N-[(2R)-butan-2-yl]-N-[2-[(4,5-dimethyl-1,3-thiazol-2-yl)amino]-2-oxoethyl]-3-phenylprop-2-enamide |
| SMILES | CC[C@@H](C)N(CC(=O)Nc1nc(C)c(C)s1)C(=O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C20H25N3O2S/c1-5-14(2)23(19(25)12-11-17-9-7-6-8-10-17)13-18(24)22-20-21-15(3)16(4)26-20/h6-12,14H,5,13H2,1-4H3,(H,21,22,24)/b12-11+/t14-/m1/s1 |
| InChIKey | YCBQKYVQXMSFJX-GCZGRYASSA-N |
| XLogP | 4.04 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.51 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|