C10H10N2OS2 — CID 861899
N-(5-methyl-4-thiophen-2-yl-1,3-thiazol-2-yl)acetamide (PubChem CID 861899) has the molecular formula C10H10N2OS2 and a molecular weight of 238.34 g/mol. Its IUPAC name is N-(5-methyl-4-thiophen-2-yl-1,3-thiazol-2-yl)acetamide.
| Compound Name | N-(5-methyl-4-thiophen-2-yl-1,3-thiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 861899 |
| Molecular Formula | C10H10N2OS2 |
| Molecular Weight | 238.34 g/mol |
| Exact Mass | 238.02 |
| IUPAC Name | N-(5-methyl-4-thiophen-2-yl-1,3-thiazol-2-yl)acetamide |
| SMILES | CC(=O)Nc1nc(-c2cccs2)c(C)s1 |
| InChI | InChI=1S/C10H10N2OS2/c1-6-9(8-4-3-5-14-8)12-10(15-6)11-7(2)13/h3-5H,1-2H3,(H,11,12,13) |
| InChIKey | RWHWNMQRAKXHQM-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.34 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |