C19H14N2OS3 — CID 7918509
N-(4,5-dithiophen-2-yl-1,3-thiazol-2-yl)-4-methylbenzamide (PubChem CID 7918509) has the molecular formula C19H14N2OS3 and a molecular weight of 382.54 g/mol. Its IUPAC name is N-(4,5-dithiophen-2-yl-1,3-thiazol-2-yl)-4-methylbenzamide.
| Compound Name | N-(4,5-dithiophen-2-yl-1,3-thiazol-2-yl)-4-methylbenzamide |
|---|---|
| PubChem CID | 7918509 |
| Molecular Formula | C19H14N2OS3 |
| Molecular Weight | 382.54 g/mol |
| Exact Mass | 382.03 |
| IUPAC Name | N-(4,5-dithiophen-2-yl-1,3-thiazol-2-yl)-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)Nc2nc(-c3cccs3)c(-c3cccs3)s2)cc1 |
| InChI | InChI=1S/C19H14N2OS3/c1-12-6-8-13(9-7-12)18(22)21-19-20-16(14-4-2-10-23-14)17(25-19)15-5-3-11-24-15/h2-11H,1H3,(H,20,21,22) |
| InChIKey | AFMZGRBJSQOFRG-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.54 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |