C14H11N3O2S — CID 7711079
4-methyl-N-(4-thiophen-2-yl-1,2,5-oxadiazol-3-yl)benzamide (PubChem CID 7711079) has the molecular formula C14H11N3O2S and a molecular weight of 285.33 g/mol. Its IUPAC name is 4-methyl-N-(4-thiophen-2-yl-1,2,5-oxadiazol-3-yl)benzamide.
| Compound Name | 4-methyl-N-(4-thiophen-2-yl-1,2,5-oxadiazol-3-yl)benzamide |
|---|---|
| PubChem CID | 7711079 |
| Molecular Formula | C14H11N3O2S |
| Molecular Weight | 285.33 g/mol |
| Exact Mass | 285.06 |
| IUPAC Name | 4-methyl-N-(4-thiophen-2-yl-1,2,5-oxadiazol-3-yl)benzamide |
| SMILES | Cc1ccc(C(=O)Nc2nonc2-c2cccs2)cc1 |
| InChI | InChI=1S/C14H11N3O2S/c1-9-4-6-10(7-5-9)14(18)15-13-12(16-19-17-13)11-3-2-8-20-11/h2-8H,1H3,(H,15,17,18) |
| InChIKey | PKSWAGIKYWHOHA-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.33 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |