C16H13N3OS — CID 3698321
4-methyl-N-(4-thiophen-2-ylpyrimidin-2-yl)benzamide (PubChem CID 3698321) has the molecular formula C16H13N3OS and a molecular weight of 295.37 g/mol. Its IUPAC name is 4-methyl-N-(4-thiophen-2-ylpyrimidin-2-yl)benzamide.
| Compound Name | 4-methyl-N-(4-thiophen-2-ylpyrimidin-2-yl)benzamide |
|---|---|
| PubChem CID | 3698321 |
| Molecular Formula | C16H13N3OS |
| Molecular Weight | 295.37 g/mol |
| Exact Mass | 295.08 |
| IUPAC Name | 4-methyl-N-(4-thiophen-2-ylpyrimidin-2-yl)benzamide |
| SMILES | Cc1ccc(C(=O)Nc2nccc(-c3cccs3)n2)cc1 |
| InChI | InChI=1S/C16H13N3OS/c1-11-4-6-12(7-5-11)15(20)19-16-17-9-8-13(18-16)14-3-2-10-21-14/h2-10H,1H3,(H,17,18,19,20) |
| InChIKey | FVTGLNWXLAYOKW-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.37 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |