C15H13N3OS2 — CID 50940930
N-(4,6-dithiophen-2-ylpyrimidin-2-yl)propanamide (PubChem CID 50940930) has the molecular formula C15H13N3OS2 and a molecular weight of 315.42 g/mol. Its IUPAC name is N-(4,6-dithiophen-2-ylpyrimidin-2-yl)propanamide.
| Compound Name | N-(4,6-dithiophen-2-ylpyrimidin-2-yl)propanamide |
|---|---|
| PubChem CID | 50940930 |
| Molecular Formula | C15H13N3OS2 |
| Molecular Weight | 315.42 g/mol |
| Exact Mass | 315.05 |
| IUPAC Name | N-(4,6-dithiophen-2-ylpyrimidin-2-yl)propanamide |
| SMILES | CCC(=O)Nc1nc(-c2cccs2)cc(-c2cccs2)n1 |
| InChI | InChI=1S/C15H13N3OS2/c1-2-14(19)18-15-16-10(12-5-3-7-20-12)9-11(17-15)13-6-4-8-21-13/h3-9H,2H2,1H3,(H,16,17,18,19) |
| InChIKey | XKXBWDHLKLDJMS-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.42 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |