C19H14N2OS2 — CID 16849310
2-naphthalen-2-yl-N-(4-thiophen-2-yl-1,3-thiazol-2-yl)acetamide (PubChem CID 16849310) has the molecular formula C19H14N2OS2 and a molecular weight of 350.47 g/mol. Its IUPAC name is 2-naphthalen-2-yl-N-(4-thiophen-2-yl-1,3-thiazol-2-yl)acetamide.
| Compound Name | 2-naphthalen-2-yl-N-(4-thiophen-2-yl-1,3-thiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 16849310 |
| Molecular Formula | C19H14N2OS2 |
| Molecular Weight | 350.47 g/mol |
| Exact Mass | 350.05 |
| IUPAC Name | 2-naphthalen-2-yl-N-(4-thiophen-2-yl-1,3-thiazol-2-yl)acetamide |
| SMILES | O=C(Cc1ccc2ccccc2c1)Nc1nc(-c2cccs2)cs1 |
| InChI | InChI=1S/C19H14N2OS2/c22-18(11-13-7-8-14-4-1-2-5-15(14)10-13)21-19-20-16(12-24-19)17-6-3-9-23-17/h1-10,12H,11H2,(H,20,21,22) |
| InChIKey | RUZNXFVXKGTTDX-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.47 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |