C14H16N2OS2 — CID 17404263
2-cyclopentyl-N-(4-thiophen-2-yl-1,3-thiazol-2-yl)acetamide (PubChem CID 17404263) has the molecular formula C14H16N2OS2 and a molecular weight of 292.43 g/mol. Its IUPAC name is 2-cyclopentyl-N-(4-thiophen-2-yl-1,3-thiazol-2-yl)acetamide.
| Compound Name | 2-cyclopentyl-N-(4-thiophen-2-yl-1,3-thiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 17404263 |
| Molecular Formula | C14H16N2OS2 |
| Molecular Weight | 292.43 g/mol |
| Exact Mass | 292.07 |
| IUPAC Name | 2-cyclopentyl-N-(4-thiophen-2-yl-1,3-thiazol-2-yl)acetamide |
| SMILES | O=C(CC1CCCC1)Nc1nc(-c2cccs2)cs1 |
| InChI | InChI=1S/C14H16N2OS2/c17-13(8-10-4-1-2-5-10)16-14-15-11(9-19-14)12-6-3-7-18-12/h3,6-7,9-10H,1-2,4-5,8H2,(H,15,16,17) |
| InChIKey | UKIOOKRUSWCWGW-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.43 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |