C14H20N2O2S — CID 115681438
N-(4-acetyl-1,3-thiazol-2-yl)-2-cycloheptylacetamide (PubChem CID 115681438) has the molecular formula C14H20N2O2S and a molecular weight of 280.39 g/mol. Its IUPAC name is N-(4-acetyl-1,3-thiazol-2-yl)-2-cycloheptylacetamide.
| Compound Name | N-(4-acetyl-1,3-thiazol-2-yl)-2-cycloheptylacetamide |
|---|---|
| PubChem CID | 115681438 |
| Molecular Formula | C14H20N2O2S |
| Molecular Weight | 280.39 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | N-(4-acetyl-1,3-thiazol-2-yl)-2-cycloheptylacetamide |
| SMILES | CC(=O)c1csc(NC(=O)CC2CCCCCC2)n1 |
| InChI | InChI=1S/C14H20N2O2S/c1-10(17)12-9-19-14(15-12)16-13(18)8-11-6-4-2-3-5-7-11/h9,11H,2-8H2,1H3,(H,15,16,18) |
| InChIKey | QRTDGVKBRZQQRW-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.39 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |