C11H17N3O2S — CID 64557705
N-(4-acetyl-1,3-thiazol-2-yl)-3-(propan-2-ylamino)propanamide (PubChem CID 64557705) has the molecular formula C11H17N3O2S and a molecular weight of 255.34 g/mol. Its IUPAC name is N-(4-acetyl-1,3-thiazol-2-yl)-3-(propan-2-ylamino)propanamide.
| Compound Name | N-(4-acetyl-1,3-thiazol-2-yl)-3-(propan-2-ylamino)propanamide |
|---|---|
| PubChem CID | 64557705 |
| Molecular Formula | C11H17N3O2S |
| Molecular Weight | 255.34 g/mol |
| Exact Mass | 255.10 |
| IUPAC Name | N-(4-acetyl-1,3-thiazol-2-yl)-3-(propan-2-ylamino)propanamide |
| SMILES | CC(=O)c1csc(NC(=O)CCNC(C)C)n1 |
| InChI | InChI=1S/C11H17N3O2S/c1-7(2)12-5-4-10(16)14-11-13-9(6-17-11)8(3)15/h6-7,12H,4-5H2,1-3H3,(H,13,14,16) |
| InChIKey | SZHVMMYKQKIZLY-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.34 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |