C12H19N3O2S — CID 64556718
N-(4-acetyl-1,3-thiazol-2-yl)-3-(tert-butylamino)propanamide (PubChem CID 64556718) has the molecular formula C12H19N3O2S and a molecular weight of 269.37 g/mol. Its IUPAC name is N-(4-acetyl-1,3-thiazol-2-yl)-3-(tert-butylamino)propanamide.
| Compound Name | N-(4-acetyl-1,3-thiazol-2-yl)-3-(tert-butylamino)propanamide |
|---|---|
| PubChem CID | 64556718 |
| Molecular Formula | C12H19N3O2S |
| Molecular Weight | 269.37 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | N-(4-acetyl-1,3-thiazol-2-yl)-3-(tert-butylamino)propanamide |
| SMILES | CC(=O)c1csc(NC(=O)CCNC(C)(C)C)n1 |
| InChI | InChI=1S/C12H19N3O2S/c1-8(16)9-7-18-11(14-9)15-10(17)5-6-13-12(2,3)4/h7,13H,5-6H2,1-4H3,(H,14,15,17) |
| InChIKey | WGYIDVJMSFLKHK-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.37 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |