C8H11N3O2S — CID 79153632
3-(4-acetyl-1,3-thiazol-2-yl)-1,1-dimethylurea (PubChem CID 79153632) has the molecular formula C8H11N3O2S and a molecular weight of 213.26 g/mol. Its IUPAC name is 3-(4-acetyl-1,3-thiazol-2-yl)-1,1-dimethylurea.
| Compound Name | 3-(4-acetyl-1,3-thiazol-2-yl)-1,1-dimethylurea |
|---|---|
| PubChem CID | 79153632 |
| Molecular Formula | C8H11N3O2S |
| Molecular Weight | 213.26 g/mol |
| Exact Mass | 213.06 |
| IUPAC Name | 3-(4-acetyl-1,3-thiazol-2-yl)-1,1-dimethylurea |
| SMILES | CC(=O)c1csc(NC(=O)N(C)C)n1 |
| InChI | InChI=1S/C8H11N3O2S/c1-5(12)6-4-14-7(9-6)10-8(13)11(2)3/h4H,1-3H3,(H,9,10,13) |
| InChIKey | VQPCUQWIHZZLRU-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.26 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |