C6H8N2O2S2 — CID 131020021
N-(4-acetyl-1,3-thiazol-2-yl)methanesulfinamide (PubChem CID 131020021) has the molecular formula C6H8N2O2S2 and a molecular weight of 204.28 g/mol. Its IUPAC name is N-(4-acetyl-1,3-thiazol-2-yl)methanesulfinamide.
| Compound Name | N-(4-acetyl-1,3-thiazol-2-yl)methanesulfinamide |
|---|---|
| PubChem CID | 131020021 |
| Molecular Formula | C6H8N2O2S2 |
| Molecular Weight | 204.28 g/mol |
| Exact Mass | 204.00 |
| IUPAC Name | N-(4-acetyl-1,3-thiazol-2-yl)methanesulfinamide |
| SMILES | CC(=O)c1csc(NS(C)=O)n1 |
| InChI | InChI=1S/C6H8N2O2S2/c1-4(9)5-3-11-6(7-5)8-12(2)10/h3H,1-2H3,(H,7,8) |
| InChIKey | LXXJGKCESSIXPO-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.28 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |