C8H13N3O3S2 — CID 114808715
1-[2-(propan-2-ylsulfamoylamino)-1,3-thiazol-4-yl]ethanone (PubChem CID 114808715) has the molecular formula C8H13N3O3S2 and a molecular weight of 263.34 g/mol. Its IUPAC name is 1-[2-(propan-2-ylsulfamoylamino)-1,3-thiazol-4-yl]ethanone.
| Compound Name | 1-[2-(propan-2-ylsulfamoylamino)-1,3-thiazol-4-yl]ethanone |
|---|---|
| PubChem CID | 114808715 |
| Molecular Formula | C8H13N3O3S2 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.04 |
| IUPAC Name | 1-[2-(propan-2-ylsulfamoylamino)-1,3-thiazol-4-yl]ethanone |
| SMILES | CC(=O)c1csc(NS(=O)(=O)NC(C)C)n1 |
| InChI | InChI=1S/C8H13N3O3S2/c1-5(2)10-16(13,14)11-8-9-7(4-15-8)6(3)12/h4-5,10H,1-3H3,(H,9,11) |
| InChIKey | DLXDTTUMXDSERS-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |