C13H15N3O3S2 — CID 64555855
N-(4-acetyl-1,3-thiazol-2-yl)-2-amino-4,5-dimethylbenzenesulfonamide (PubChem CID 64555855) has the molecular formula C13H15N3O3S2 and a molecular weight of 325.42 g/mol. Its IUPAC name is N-(4-acetyl-1,3-thiazol-2-yl)-2-amino-4,5-dimethylbenzenesulfonamide.
| Compound Name | N-(4-acetyl-1,3-thiazol-2-yl)-2-amino-4,5-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 64555855 |
| Molecular Formula | C13H15N3O3S2 |
| Molecular Weight | 325.42 g/mol |
| Exact Mass | 325.06 |
| IUPAC Name | N-(4-acetyl-1,3-thiazol-2-yl)-2-amino-4,5-dimethylbenzenesulfonamide |
| SMILES | CC(=O)c1csc(NS(=O)(=O)c2cc(C)c(C)cc2N)n1 |
| InChI | InChI=1S/C13H15N3O3S2/c1-7-4-10(14)12(5-8(7)2)21(18,19)16-13-15-11(6-20-13)9(3)17/h4-6H,14H2,1-3H3,(H,15,16) |
| InChIKey | SRWDBPKPQZICRY-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 102.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.42 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|