C12H12BrN3O3S2 — CID 114625789
N-(4-acetyl-1,3-thiazol-2-yl)-5-amino-4-bromo-2-methylbenzenesulfonamide (PubChem CID 114625789) has the molecular formula C12H12BrN3O3S2 and a molecular weight of 390.28 g/mol. Its IUPAC name is N-(4-acetyl-1,3-thiazol-2-yl)-5-amino-4-bromo-2-methylbenzenesulfonamide.
| Compound Name | N-(4-acetyl-1,3-thiazol-2-yl)-5-amino-4-bromo-2-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 114625789 |
| Molecular Formula | C12H12BrN3O3S2 |
| Molecular Weight | 390.28 g/mol |
| Exact Mass | 388.95 |
| IUPAC Name | N-(4-acetyl-1,3-thiazol-2-yl)-5-amino-4-bromo-2-methylbenzenesulfonamide |
| SMILES | CC(=O)c1csc(NS(=O)(=O)c2cc(N)c(Br)cc2C)n1 |
| InChI | InChI=1S/C12H12BrN3O3S2/c1-6-3-8(13)9(14)4-11(6)21(18,19)16-12-15-10(5-20-12)7(2)17/h3-5H,14H2,1-2H3,(H,15,16) |
| InChIKey | HYZHLCLKXPYYFJ-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 102.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.28 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|