C13H15N3O3S2 — CID 77046980
N-[4-(N-hydroxy-C-methylcarbonimidoyl)-1,3-thiazol-2-yl]-2,5-dimethylbenzenesulfonamide (PubChem CID 77046980) has the molecular formula C13H15N3O3S2 and a molecular weight of 325.42 g/mol. Its IUPAC name is N-[4-(N-hydroxy-C-methylcarbonimidoyl)-1,3-thiazol-2-yl]-2,5-dimethylbenzenesulfonamide.
| Compound Name | N-[4-(N-hydroxy-C-methylcarbonimidoyl)-1,3-thiazol-2-yl]-2,5-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 77046980 |
| Molecular Formula | C13H15N3O3S2 |
| Molecular Weight | 325.42 g/mol |
| Exact Mass | 325.06 |
| IUPAC Name | N-[4-(N-hydroxy-C-methylcarbonimidoyl)-1,3-thiazol-2-yl]-2,5-dimethylbenzenesulfonamide |
| SMILES | CC(=NO)c1csc(NS(=O)(=O)c2cc(C)ccc2C)n1 |
| InChI | InChI=1S/C13H15N3O3S2/c1-8-4-5-9(2)12(6-8)21(18,19)16-13-14-11(7-20-13)10(3)15-17/h4-7,17H,1-3H3,(H,14,16) |
| InChIKey | MSYYQUNBOSIOHT-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 91.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.42 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|